C26H27N2+ — CID 155638456
1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methyl-6-pyridin-3-ylisoquinolin-2-ium (PubChem CID 155638456) has the molecular formula C26H27N2+ and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methyl-6-pyridin-3-ylisoquinolin-2-ium.
| Compound Name | 1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methyl-6-pyridin-3-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638456 |
| Molecular Formula | C26H27N2+ |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methyl-6-pyridin-3-ylisoquinolin-2-ium |
| SMILES | Cc1cc(C(C)C)cc(-c2c3ccc(-c4cccnc4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C26H27N2/c1-17(2)23-13-18(3)19(4)25(15-23)26-24-9-8-20(22-7-6-11-27-16-22)14-21(24)10-12-28(26)5/h6-17H,1-5H3/q+1 |
| InChIKey | PJWVRIQMORPKTC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|