C33H50NSi+ — CID 155637578
[1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane (PubChem CID 155637578) has the molecular formula C33H50NSi+ and a molecular weight of 488.86 g/mol. Its IUPAC name is [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane.
| Compound Name | [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane |
|---|---|
| PubChem CID | 155637578 |
| Molecular Formula | C33H50NSi+ |
| Molecular Weight | 488.86 g/mol |
| Exact Mass | 488.37 |
| IUPAC Name | [1-(2,3-dimethyl-5-propan-2-ylphenyl)-2-methylisoquinolin-2-ium-6-yl]-tris(2-methylpropyl)silane |
| SMILES | Cc1cc(C(C)C)cc(-c2c3ccc([Si](CC(C)C)(CC(C)C)CC(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C33H50NSi/c1-22(2)19-35(20-23(3)4,21-24(5)6)30-12-13-31-28(17-30)14-15-34(11)33(31)32-18-29(25(7)8)16-26(9)27(32)10/h12-18,22-25H,19-21H2,1-11H3/q+1 |
| InChIKey | GACOYKPYRDNMMV-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.86 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|