C29H36NSi+ — CID 166015601
triethyl-[3-methyl-4-(2,3,5-trimethylphenyl)benzo[f]isoquinolin-3-ium-8-yl]silane (PubChem CID 166015601) has the molecular formula C29H36NSi+ and a molecular weight of 426.70 g/mol. Its IUPAC name is triethyl-[3-methyl-4-(2,3,5-trimethylphenyl)benzo[f]isoquinolin-3-ium-8-yl]silane.
| Compound Name | triethyl-[3-methyl-4-(2,3,5-trimethylphenyl)benzo[f]isoquinolin-3-ium-8-yl]silane |
|---|---|
| PubChem CID | 166015601 |
| Molecular Formula | C29H36NSi+ |
| Molecular Weight | 426.70 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | triethyl-[3-methyl-4-(2,3,5-trimethylphenyl)benzo[f]isoquinolin-3-ium-8-yl]silane |
| SMILES | CC[Si](CC)(CC)c1ccc2c(ccc3c(-c4cc(C)cc(C)c4C)[n+](C)ccc32)c1 |
| InChI | InChI=1S/C29H36NSi/c1-8-31(9-2,10-3)24-12-14-25-23(19-24)11-13-27-26(25)15-16-30(7)29(27)28-18-20(4)17-21(5)22(28)6/h11-19H,8-10H2,1-7H3/q+1 |
| InChIKey | AIPPRTNQYDXQFZ-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.70 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|