C30H29F3NS+ — CID 166015632
7-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-6-(2,3,5-trimethylphenyl)-[1]benzothiolo[5,4-f]isoquinolin-7-ium (PubChem CID 166015632) has the molecular formula C30H29F3NS+ and a molecular weight of 492.63 g/mol. Its IUPAC name is 7-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-6-(2,3,5-trimethylphenyl)-[1]benzothiolo[5,4-f]isoquinolin-7-ium.
| Compound Name | 7-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-6-(2,3,5-trimethylphenyl)-[1]benzothiolo[5,4-f]isoquinolin-7-ium |
|---|---|
| PubChem CID | 166015632 |
| Molecular Formula | C30H29F3NS+ |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 7-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-6-(2,3,5-trimethylphenyl)-[1]benzothiolo[5,4-f]isoquinolin-7-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3ccc4c5cc(CC(C)(C)C(F)(F)F)sc5ccc4c3cc[n+]2C)c1 |
| InChI | InChI=1S/C30H29F3NS/c1-17-13-18(2)19(3)25(14-17)28-24-8-7-22-21(23(24)11-12-34(28)6)9-10-27-26(22)15-20(35-27)16-29(4,5)30(31,32)33/h7-15H,16H2,1-6H3/q+1 |
| InChIKey | HSYALSXMVOIPFO-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|