C21H20NS+ — CID 176592451
7-methyl-8-(2,3,5-trimethylphenyl)thieno[3,2-g]isoquinolin-7-ium (PubChem CID 176592451) has the molecular formula C21H20NS+ and a molecular weight of 318.47 g/mol. Its IUPAC name is 7-methyl-8-(2,3,5-trimethylphenyl)thieno[3,2-g]isoquinolin-7-ium.
| Compound Name | 7-methyl-8-(2,3,5-trimethylphenyl)thieno[3,2-g]isoquinolin-7-ium |
|---|---|
| PubChem CID | 176592451 |
| Molecular Formula | C21H20NS+ |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 7-methyl-8-(2,3,5-trimethylphenyl)thieno[3,2-g]isoquinolin-7-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3cc4sccc4cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C21H20NS/c1-13-9-14(2)15(3)18(10-13)21-19-12-20-17(6-8-23-20)11-16(19)5-7-22(21)4/h5-12H,1-4H3/q+1 |
| InChIKey | DYPNBCCJVGCAMB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|