C17H18NO+ — CID 166501216
6-methyl-7-(2,3,5-trimethylphenyl)furo[2,3-c]pyridin-6-ium (PubChem CID 166501216) has the molecular formula C17H18NO+ and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-methyl-7-(2,3,5-trimethylphenyl)furo[2,3-c]pyridin-6-ium.
| Compound Name | 6-methyl-7-(2,3,5-trimethylphenyl)furo[2,3-c]pyridin-6-ium |
|---|---|
| PubChem CID | 166501216 |
| Molecular Formula | C17H18NO+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 6-methyl-7-(2,3,5-trimethylphenyl)furo[2,3-c]pyridin-6-ium |
| SMILES | Cc1cc(C)c(C)c(-c2c3occc3cc[n+]2C)c1 |
| InChI | InChI=1S/C17H18NO/c1-11-9-12(2)13(3)15(10-11)16-17-14(6-8-19-17)5-7-18(16)4/h5-10H,1-4H3/q+1 |
| InChIKey | PRTUWVTZOVKYOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|