C19H20N+ — CID 155639104
6-deuterio-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium (PubChem CID 155639104) has the molecular formula C19H20N+ and a molecular weight of 269.42 g/mol. Its IUPAC name is 6-deuterio-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium.
| Compound Name | 6-deuterio-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 155639104 |
| Molecular Formula | C19H20N+ |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | 6-deuterio-2-methyl-1-[2-methyl-3,5-bis(trideuteriomethyl)phenyl]isoquinolin-2-ium |
| SMILES | [2H]c1ccc2c(-c3cc(C([2H])([2H])[2H])cc(C([2H])([2H])[2H])c3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C19H20N/c1-13-11-14(2)15(3)18(12-13)19-17-8-6-5-7-16(17)9-10-20(19)4/h5-12H,1-4H3/q+1/i1D3,2D3,5D |
| InChIKey | RBWNYZJIDOVWCW-TXVPSQRDSA-N |
| XLogP | 4.26 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|