C30H36N+ — CID 158210706
6-(1-adamantyl)-1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2-methylisoquinolin-2-ium (PubChem CID 158210706) has the molecular formula C30H36N+ and a molecular weight of 415.66 g/mol. Its IUPAC name is 6-(1-adamantyl)-1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2-methylisoquinolin-2-ium.
| Compound Name | 6-(1-adamantyl)-1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 158210706 |
| Molecular Formula | C30H36N+ |
| Molecular Weight | 415.66 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | 6-(1-adamantyl)-1-[3-(1,1-dideuterioethyl)-2-methyl-5-(trideuteriomethyl)phenyl]-2-methylisoquinolin-2-ium |
| SMILES | [2H]C([2H])([2H])c1cc(-c2c3ccc(C45CC6CC(CC(C6)C4)C5)cc3cc[n+]2C)c(C)c(C([2H])([2H])C)c1 |
| InChI | InChI=1S/C30H36N/c1-5-24-10-19(2)11-28(20(24)3)29-27-7-6-26(15-25(27)8-9-31(29)4)30-16-21-12-22(17-30)14-23(13-21)18-30/h6-11,15,21-23H,5,12-14,16-18H2,1-4H3/q+1/i2D3,5D2 |
| InChIKey | ZPGVSAPTKBAIOR-ZTIZGVCASA-N |
| XLogP | 6.98 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.66 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|