C34H36N+ — CID 155639065
6-(1-adamantyl)-1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155639065) has the molecular formula C34H36N+ and a molecular weight of 458.67 g/mol. Its IUPAC name is 6-(1-adamantyl)-1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(1-adamantyl)-1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639065 |
| Molecular Formula | C34H36N+ |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | 6-(1-adamantyl)-1-(2,3-dimethyl-5-phenylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2c3ccc(C45CC6CC(CC(C6)C4)C5)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C34H36N/c1-22-13-29(27-7-5-4-6-8-27)18-32(23(22)2)33-31-10-9-30(17-28(31)11-12-35(33)3)34-19-24-14-25(20-34)16-26(15-24)21-34/h4-13,17-18,24-26H,14-16,19-21H2,1-3H3/q+1 |
| InChIKey | QOYUTWOMYSNNCT-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|