C29H32N+ — CID 155638467
1-(2,3-dimethyl-5-phenylphenyl)-6-(2,2-dimethylpropyl)-2-methylisoquinolin-2-ium (PubChem CID 155638467) has the molecular formula C29H32N+ and a molecular weight of 394.58 g/mol. Its IUPAC name is 1-(2,3-dimethyl-5-phenylphenyl)-6-(2,2-dimethylpropyl)-2-methylisoquinolin-2-ium.
| Compound Name | 1-(2,3-dimethyl-5-phenylphenyl)-6-(2,2-dimethylpropyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638467 |
| Molecular Formula | C29H32N+ |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 1-(2,3-dimethyl-5-phenylphenyl)-6-(2,2-dimethylpropyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1cc(-c2ccccc2)cc(-c2c3ccc(CC(C)(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C29H32N/c1-20-16-25(23-10-8-7-9-11-23)18-27(21(20)2)28-26-13-12-22(19-29(3,4)5)17-24(26)14-15-30(28)6/h7-18H,19H2,1-6H3/q+1 |
| InChIKey | ZCIABKSYHZDHEY-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|