C24H30N+ — CID 160742303
3,4-dideuterio-6-(2,2-dimethylpropyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium (PubChem CID 160742303) has the molecular formula C24H30N+ and a molecular weight of 334.52 g/mol. Its IUPAC name is 3,4-dideuterio-6-(2,2-dimethylpropyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium.
| Compound Name | 3,4-dideuterio-6-(2,2-dimethylpropyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 160742303 |
| Molecular Formula | C24H30N+ |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 3,4-dideuterio-6-(2,2-dimethylpropyl)-2-methyl-1-(2,3,5-trimethylphenyl)isoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C)cc(C)c2C)c2ccc(CC(C)(C)C)cc12 |
| InChI | InChI=1S/C24H30N/c1-16-12-17(2)18(3)22(13-16)23-21-9-8-19(15-24(4,5)6)14-20(21)10-11-25(23)7/h8-14H,15H2,1-7H3/q+1/i10D,11D |
| InChIKey | UDTKMYYUBVVHLZ-MIBQVNFTSA-N |
| XLogP | 5.85 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|