C29H40N+ — CID 158128322
3,4-dideuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium (PubChem CID 158128322) has the molecular formula C29H40N+ and a molecular weight of 404.66 g/mol. Its IUPAC name is 3,4-dideuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium.
| Compound Name | 3,4-dideuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 158128322 |
| Molecular Formula | C29H40N+ |
| Molecular Weight | 404.66 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 3,4-dideuterio-1-(3,5-ditert-butyl-2-methylphenyl)-2-methyl-6-(2-methylpropyl)isoquinolin-2-ium |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2C)c2ccc(CC(C)C)cc12 |
| InChI | InChI=1S/C29H40N/c1-19(2)15-21-11-12-24-22(16-21)13-14-30(10)27(24)25-17-23(28(4,5)6)18-26(20(25)3)29(7,8)9/h11-14,16-19H,15H2,1-10H3/q+1/i13D,14D |
| InChIKey | WBLPMWPDWILXCU-FLZZRPEZSA-N |
| XLogP | 7.43 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.66 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|