C32H46NSi+ — CID 155639300
3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium (PubChem CID 155639300) has the molecular formula C32H46NSi+ and a molecular weight of 473.82 g/mol. Its IUPAC name is 3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium.
| Compound Name | 3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639300 |
| Molecular Formula | C32H46NSi+ |
| Molecular Weight | 473.82 g/mol |
| Exact Mass | 473.35 |
| IUPAC Name | 3-deuterio-1-(3,5-ditert-butyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium |
| SMILES | [2H]c1cc2cc(C3CC[Si](C)(C)CC3)ccc2c(-c2cc(C(C)(C)C)cc(C(C)(C)C)c2C)[n+]1C |
| InChI | InChI=1S/C32H46NSi/c1-22-28(20-26(31(2,3)4)21-29(22)32(5,6)7)30-27-12-11-24(19-25(27)13-16-33(30)8)23-14-17-34(9,10)18-15-23/h11-13,16,19-21,23H,14-15,17-18H2,1-10H3/q+1/i16D |
| InChIKey | DFWZDMYXWXQOGM-QNLPYAOMSA-N |
| XLogP | 8.82 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.82 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|