C36H50NSi+ — CID 155638567
1-(3,5-dicyclohexyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium (PubChem CID 155638567) has the molecular formula C36H50NSi+ and a molecular weight of 524.89 g/mol. Its IUPAC name is 1-(3,5-dicyclohexyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium.
| Compound Name | 1-(3,5-dicyclohexyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638567 |
| Molecular Formula | C36H50NSi+ |
| Molecular Weight | 524.89 g/mol |
| Exact Mass | 524.37 |
| IUPAC Name | 1-(3,5-dicyclohexyl-2-methylphenyl)-6-(1,1-dimethylsilinan-4-yl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccc(C4CC[Si](C)(C)CC4)cc3cc[n+]2C)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C36H50NSi/c1-26-34(29-13-9-6-10-14-29)24-32(27-11-7-5-8-12-27)25-35(26)36-33-16-15-30(23-31(33)17-20-37(36)2)28-18-21-38(3,4)22-19-28/h15-17,20,23-25,27-29H,5-14,18-19,21-22H2,1-4H3/q+1 |
| InChIKey | CUWKXGODWUUCAO-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.89 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|