C30H40NSi+ — CID 159606041
[3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane (PubChem CID 159606041) has the molecular formula C30H40NSi+ and a molecular weight of 444.76 g/mol. Its IUPAC name is [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane.
| Compound Name | [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane |
|---|---|
| PubChem CID | 159606041 |
| Molecular Formula | C30H40NSi+ |
| Molecular Weight | 444.76 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | [3,4-dideuterio-1-(3,5-dicyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-trimethylsilane |
| SMILES | [2H]c1c([2H])[n+](C)c(-c2cc(C3CCCC3)cc(C3CCCC3)c2C)c2ccc([Si](C)(C)C)cc12 |
| InChI | InChI=1S/C30H40NSi/c1-21-28(23-12-8-9-13-23)19-25(22-10-6-7-11-22)20-29(21)30-27-15-14-26(32(3,4)5)18-24(27)16-17-31(30)2/h14-20,22-23H,6-13H2,1-5H3/q+1/i16D,17D |
| InChIKey | UYLSNCMSEUJPGH-OSLBFGEZSA-N |
| XLogP | 7.50 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.76 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|