C34H46NSi+ — CID 155638124
1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium (PubChem CID 155638124) has the molecular formula C34H46NSi+ and a molecular weight of 496.84 g/mol. Its IUPAC name is 1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium.
| Compound Name | 1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155638124 |
| Molecular Formula | C34H46NSi+ |
| Molecular Weight | 496.84 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 1-(3,5-dicyclohexyl-2-methylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccc([Si]4(C)CCCC4)cc3cc[n+]2C)cc(C2CCCCC2)cc1C1CCCCC1 |
| InChI | InChI=1S/C34H46NSi/c1-25-32(27-14-8-5-9-15-27)23-29(26-12-6-4-7-13-26)24-33(25)34-31-17-16-30(36(3)20-10-11-21-36)22-28(31)18-19-35(34)2/h16-19,22-24,26-27H,4-15,20-21H2,1-3H3/q+1 |
| InChIKey | JZZUTYYIRZZPIW-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.84 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|