C27H36NSi+ — CID 155637991
1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium (PubChem CID 155637991) has the molecular formula C27H36NSi+ and a molecular weight of 402.68 g/mol. Its IUPAC name is 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155637991 |
| Molecular Formula | C27H36NSi+ |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-(1-methylsilolan-1-yl)isoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c3ccc([Si]4(C)CCCC4)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C27H36NSi/c1-19-16-22(27(3,4)5)18-25(20(19)2)26-24-11-10-23(29(7)14-8-9-15-29)17-21(24)12-13-28(26)6/h10-13,16-18H,8-9,14-15H2,1-7H3/q+1 |
| InChIKey | GWBHPBXHPTVAEG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|