C30H40N+ — CID 155638889
6-cyclopentyl-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155638889) has the molecular formula C30H40N+ and a molecular weight of 414.66 g/mol. Its IUPAC name is 6-cyclopentyl-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-cyclopentyl-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155638889 |
| Molecular Formula | C30H40N+ |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 6-cyclopentyl-1-(3,5-ditert-butyl-2-methylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1c(-c2c3ccc(C4CCCC4)cc3cc[n+]2C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C30H40N/c1-20-26(18-24(29(2,3)4)19-27(20)30(5,6)7)28-25-14-13-22(21-11-9-10-12-21)17-23(25)15-16-31(28)8/h13-19,21H,9-12H2,1-8H3/q+1 |
| InChIKey | BBHMHOBGKUZFAS-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|