C33H40NSi+ — CID 155637912
[1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-(2-phenylpropan-2-yl)silane (PubChem CID 155637912) has the molecular formula C33H40NSi+ and a molecular weight of 478.78 g/mol. Its IUPAC name is [1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-(2-phenylpropan-2-yl)silane.
| Compound Name | [1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-(2-phenylpropan-2-yl)silane |
|---|---|
| PubChem CID | 155637912 |
| Molecular Formula | C33H40NSi+ |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | [1-(5-cyclopentyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-dimethyl-(2-phenylpropan-2-yl)silane |
| SMILES | Cc1ccc(C2CCCC2)cc1-c1c2ccc([Si](C)(C)C(C)(C)c3ccccc3)cc2cc[n+]1C |
| InChI | InChI=1S/C33H40NSi/c1-24-16-17-26(25-12-10-11-13-25)23-31(24)32-30-19-18-29(22-27(30)20-21-34(32)4)35(5,6)33(2,3)28-14-8-7-9-15-28/h7-9,14-23,25H,10-13H2,1-6H3/q+1 |
| InChIKey | LMLGLNXZTKBKDW-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|