C39H44NSi+ — CID 155637999
tert-butyl-[1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diphenylsilane (PubChem CID 155637999) has the molecular formula C39H44NSi+ and a molecular weight of 554.87 g/mol. Its IUPAC name is tert-butyl-[1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diphenylsilane.
| Compound Name | tert-butyl-[1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diphenylsilane |
|---|---|
| PubChem CID | 155637999 |
| Molecular Formula | C39H44NSi+ |
| Molecular Weight | 554.87 g/mol |
| Exact Mass | 554.32 |
| IUPAC Name | tert-butyl-[1-(5-cyclohexyl-2-methylphenyl)-2-methylisoquinolin-2-ium-6-yl]-diphenylsilane |
| SMILES | Cc1ccc(C2CCCCC2)cc1-c1c2ccc([Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C39H44NSi/c1-29-21-22-31(30-15-9-6-10-16-30)28-37(29)38-36-24-23-35(27-32(36)25-26-40(38)5)41(39(2,3)4,33-17-11-7-12-18-33)34-19-13-8-14-20-34/h7-8,11-14,17-28,30H,6,9-10,15-16H2,1-5H3/q+1 |
| InChIKey | XNASSPXYLGDUKJ-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.87 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|