C30H34NSi+ — CID 155637545
cyclopentyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane (PubChem CID 155637545) has the molecular formula C30H34NSi+ and a molecular weight of 436.70 g/mol. Its IUPAC name is cyclopentyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane.
| Compound Name | cyclopentyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane |
|---|---|
| PubChem CID | 155637545 |
| Molecular Formula | C30H34NSi+ |
| Molecular Weight | 436.70 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | cyclopentyl-dimethyl-[2-methyl-1-(2-methyl-5-phenylphenyl)isoquinolin-2-ium-6-yl]silane |
| SMILES | Cc1ccc(-c2ccccc2)cc1-c1c2ccc([Si](C)(C)C3CCCC3)cc2cc[n+]1C |
| InChI | InChI=1S/C30H34NSi/c1-22-14-15-24(23-10-6-5-7-11-23)21-29(22)30-28-17-16-27(20-25(28)18-19-31(30)2)32(3,4)26-12-8-9-13-26/h5-7,10-11,14-21,26H,8-9,12-13H2,1-4H3/q+1 |
| InChIKey | WPKBOHZOAUEGEK-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.70 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|