C27H33N2Si+ — CID 155637583
4-[6-[cyclopentyl(dimethyl)silyl]-2-methylisoquinolin-2-ium-1-yl]-2,3,6-trimethylbenzonitrile (PubChem CID 155637583) has the molecular formula C27H33N2Si+ and a molecular weight of 413.66 g/mol. Its IUPAC name is 4-[6-[cyclopentyl(dimethyl)silyl]-2-methylisoquinolin-2-ium-1-yl]-2,3,6-trimethylbenzonitrile.
| Compound Name | 4-[6-[cyclopentyl(dimethyl)silyl]-2-methylisoquinolin-2-ium-1-yl]-2,3,6-trimethylbenzonitrile |
|---|---|
| PubChem CID | 155637583 |
| Molecular Formula | C27H33N2Si+ |
| Molecular Weight | 413.66 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-[6-[cyclopentyl(dimethyl)silyl]-2-methylisoquinolin-2-ium-1-yl]-2,3,6-trimethylbenzonitrile |
| SMILES | Cc1cc(-c2c3ccc([Si](C)(C)C4CCCC4)cc3cc[n+]2C)c(C)c(C)c1C#N |
| InChI | InChI=1S/C27H33N2Si/c1-18-15-25(19(2)20(3)26(18)17-28)27-24-12-11-23(16-21(24)13-14-29(27)4)30(5,6)22-9-7-8-10-22/h11-16,22H,7-10H2,1-6H3/q+1 |
| InChIKey | UDSVCXLGARHQQJ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|