C26H33N2Si+ — CID 155638177
2,3,6-trimethyl-4-(2-methyl-6-triethylsilylisoquinolin-2-ium-1-yl)benzonitrile (PubChem CID 155638177) has the molecular formula C26H33N2Si+ and a molecular weight of 401.65 g/mol. Its IUPAC name is 2,3,6-trimethyl-4-(2-methyl-6-triethylsilylisoquinolin-2-ium-1-yl)benzonitrile.
| Compound Name | 2,3,6-trimethyl-4-(2-methyl-6-triethylsilylisoquinolin-2-ium-1-yl)benzonitrile |
|---|---|
| PubChem CID | 155638177 |
| Molecular Formula | C26H33N2Si+ |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2,3,6-trimethyl-4-(2-methyl-6-triethylsilylisoquinolin-2-ium-1-yl)benzonitrile |
| SMILES | CC[Si](CC)(CC)c1ccc2c(-c3cc(C)c(C#N)c(C)c3C)[n+](C)ccc2c1 |
| InChI | InChI=1S/C26H33N2Si/c1-8-29(9-2,10-3)22-11-12-23-21(16-22)13-14-28(7)26(23)24-15-18(4)25(17-27)20(6)19(24)5/h11-16H,8-10H2,1-7H3/q+1 |
| InChIKey | MDPOHNVPQLPQCC-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 27.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|