C29H42NSi+ — CID 155637750
tert-butyl-diethyl-[1-(5-ethyl-2,3,4-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]silane (PubChem CID 155637750) has the molecular formula C29H42NSi+ and a molecular weight of 432.75 g/mol. Its IUPAC name is tert-butyl-diethyl-[1-(5-ethyl-2,3,4-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]silane.
| Compound Name | tert-butyl-diethyl-[1-(5-ethyl-2,3,4-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]silane |
|---|---|
| PubChem CID | 155637750 |
| Molecular Formula | C29H42NSi+ |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | tert-butyl-diethyl-[1-(5-ethyl-2,3,4-trimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]silane |
| SMILES | CCc1cc(-c2c3ccc([Si](CC)(CC)C(C)(C)C)cc3cc[n+]2C)c(C)c(C)c1C |
| InChI | InChI=1S/C29H42NSi/c1-11-23-19-27(22(6)20(4)21(23)5)28-26-15-14-25(18-24(26)16-17-30(28)10)31(12-2,13-3)29(7,8)9/h14-19H,11-13H2,1-10H3/q+1 |
| InChIKey | JZWYUQVMGWKVRJ-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|