C27H38NSi+ — CID 155637581
ditert-butyl-[1-(2,5-dimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-methylsilane (PubChem CID 155637581) has the molecular formula C27H38NSi+ and a molecular weight of 404.69 g/mol. Its IUPAC name is ditert-butyl-[1-(2,5-dimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-methylsilane.
| Compound Name | ditert-butyl-[1-(2,5-dimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-methylsilane |
|---|---|
| PubChem CID | 155637581 |
| Molecular Formula | C27H38NSi+ |
| Molecular Weight | 404.69 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | ditert-butyl-[1-(2,5-dimethylphenyl)-2-methylisoquinolin-2-ium-6-yl]-methylsilane |
| SMILES | Cc1ccc(C)c(-c2c3ccc([Si](C)(C(C)(C)C)C(C)(C)C)cc3cc[n+]2C)c1 |
| InChI | InChI=1S/C27H38NSi/c1-19-11-12-20(2)24(17-19)25-23-14-13-22(18-21(23)15-16-28(25)9)29(10,26(3,4)5)27(6,7)8/h11-18H,1-10H3/q+1 |
| InChIKey | MTACOBLBQALIGE-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|