C24H25N2Si+ — CID 155638218
dimethyl-[2-methyl-1-(2-methylphenyl)isoquinolin-2-ium-6-yl]-pyridin-2-ylsilane (PubChem CID 155638218) has the molecular formula C24H25N2Si+ and a molecular weight of 369.56 g/mol. Its IUPAC name is dimethyl-[2-methyl-1-(2-methylphenyl)isoquinolin-2-ium-6-yl]-pyridin-2-ylsilane.
| Compound Name | dimethyl-[2-methyl-1-(2-methylphenyl)isoquinolin-2-ium-6-yl]-pyridin-2-ylsilane |
|---|---|
| PubChem CID | 155638218 |
| Molecular Formula | C24H25N2Si+ |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | dimethyl-[2-methyl-1-(2-methylphenyl)isoquinolin-2-ium-6-yl]-pyridin-2-ylsilane |
| SMILES | Cc1ccccc1-c1c2ccc([Si](C)(C)c3ccccn3)cc2cc[n+]1C |
| InChI | InChI=1S/C24H25N2Si/c1-18-9-5-6-10-21(18)24-22-13-12-20(17-19(22)14-16-26(24)2)27(3,4)23-11-7-8-15-25-23/h5-17H,1-4H3/q+1 |
| InChIKey | ORRKWCIZMHDASE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|