C18H18N+ — CID 155638697
3-deuterio-2,6-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium (PubChem CID 155638697) has the molecular formula C18H18N+ and a molecular weight of 249.36 g/mol. Its IUPAC name is 3-deuterio-2,6-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium.
| Compound Name | 3-deuterio-2,6-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 155638697 |
| Molecular Formula | C18H18N+ |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 3-deuterio-2,6-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium |
| SMILES | [2H]c1cc2cc(C)ccc2c(-c2ccccc2C)[n+]1C |
| InChI | InChI=1S/C18H18N/c1-13-8-9-17-15(12-13)10-11-19(3)18(17)16-7-5-4-6-14(16)2/h4-12H,1-3H3/q+1/i11D |
| InChIKey | BEGBGZCZNYOSQL-WORMITQPSA-N |
| XLogP | 3.95 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|