C18H17FN+ — CID 159041966
4-deuterio-6-fluoro-2,3-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium (PubChem CID 159041966) has the molecular formula C18H17FN+ and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-deuterio-6-fluoro-2,3-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium.
| Compound Name | 4-deuterio-6-fluoro-2,3-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 159041966 |
| Molecular Formula | C18H17FN+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-deuterio-6-fluoro-2,3-dimethyl-1-(2-methylphenyl)isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2ccccc2C)c2ccc(F)cc12 |
| InChI | InChI=1S/C18H17FN/c1-12-6-4-5-7-16(12)18-17-9-8-15(19)11-14(17)10-13(2)20(18)3/h4-11H,1-3H3/q+1/i10D |
| InChIKey | NJMARQFPHQVKEO-MMIHMFRQSA-N |
| XLogP | 4.09 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|