C27H26N+ — CID 159204973
4-deuterio-2,3-dimethyl-1-(2-methyl-4-phenylphenyl)-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium (PubChem CID 159204973) has the molecular formula C27H26N+ and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-deuterio-2,3-dimethyl-1-(2-methyl-4-phenylphenyl)-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium.
| Compound Name | 4-deuterio-2,3-dimethyl-1-(2-methyl-4-phenylphenyl)-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium |
|---|---|
| PubChem CID | 159204973 |
| Molecular Formula | C27H26N+ |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-deuterio-2,3-dimethyl-1-(2-methyl-4-phenylphenyl)-7,8-dihydro-6H-cyclopenta[g]isoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2ccc(-c3ccccc3)cc2C)c2cc3c(cc12)CCC3 |
| InChI | InChI=1S/C27H26N/c1-18-14-23(20-8-5-4-6-9-20)12-13-25(18)27-26-17-22-11-7-10-21(22)16-24(26)15-19(2)28(27)3/h4-6,8-9,12-17H,7,10-11H2,1-3H3/q+1/i15D |
| InChIKey | XWDWNQZMJQPANB-RWFJLFJASA-N |
| XLogP | 6.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|