C28H29FN+ — CID 160846919
6-butan-2-yl-4-deuterio-1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethylisoquinolin-2-ium (PubChem CID 160846919) has the molecular formula C28H29FN+ and a molecular weight of 399.55 g/mol. Its IUPAC name is 6-butan-2-yl-4-deuterio-1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethylisoquinolin-2-ium.
| Compound Name | 6-butan-2-yl-4-deuterio-1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethylisoquinolin-2-ium |
|---|---|
| PubChem CID | 160846919 |
| Molecular Formula | C28H29FN+ |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 6-butan-2-yl-4-deuterio-1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethylisoquinolin-2-ium |
| SMILES | [2H]c1c(C)[n+](C)c(-c2cc(-c3ccccc3)c(F)cc2C)c2ccc(C(C)CC)cc12 |
| InChI | InChI=1S/C28H29FN/c1-6-18(2)22-12-13-24-23(16-22)15-20(4)30(5)28(24)25-17-26(27(29)14-19(25)3)21-10-8-7-9-11-21/h7-18H,6H2,1-5H3/q+1/i15D |
| InChIKey | ZXXOSVAGSMTEOO-RWFJLFJASA-N |
| XLogP | 7.27 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|