C27H27FN+ — CID 157412096
1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-6-propan-2-ylisoquinolin-2-ium (PubChem CID 157412096) has the molecular formula C27H27FN+ and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-6-propan-2-ylisoquinolin-2-ium.
| Compound Name | 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-6-propan-2-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 157412096 |
| Molecular Formula | C27H27FN+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(4-fluoro-2-methyl-5-phenylphenyl)-2,3-dimethyl-6-propan-2-ylisoquinolin-2-ium |
| SMILES | Cc1cc(F)c(-c2ccccc2)cc1-c1c2ccc(C(C)C)cc2cc(C)[n+]1C |
| InChI | InChI=1S/C27H27FN/c1-17(2)21-11-12-23-22(15-21)14-19(4)29(5)27(23)24-16-25(26(28)13-18(24)3)20-9-7-6-8-10-20/h6-17H,1-5H3/q+1 |
| InChIKey | XCDCXWPJCOCJIT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|