C30H33FN+ — CID 155639228
6-(2,4-dimethylpentan-3-yl)-1-(4-fluoro-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium (PubChem CID 155639228) has the molecular formula C30H33FN+ and a molecular weight of 426.60 g/mol. Its IUPAC name is 6-(2,4-dimethylpentan-3-yl)-1-(4-fluoro-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(2,4-dimethylpentan-3-yl)-1-(4-fluoro-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 155639228 |
| Molecular Formula | C30H33FN+ |
| Molecular Weight | 426.60 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 6-(2,4-dimethylpentan-3-yl)-1-(4-fluoro-2-methyl-5-phenylphenyl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1cc(F)c(-c2ccccc2)cc1-c1c2ccc(C(C(C)C)C(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C30H33FN/c1-19(2)29(20(3)4)24-12-13-25-23(17-24)14-15-32(6)30(25)26-18-27(28(31)16-21(26)5)22-10-8-7-9-11-22/h7-20,29H,1-6H3/q+1 |
| InChIKey | XSQZWBMKYRGCMZ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.60 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|