C25H23N2+ — CID 169300962
1-(4-isocyano-1-methylnaphthalen-2-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium (PubChem CID 169300962) has the molecular formula C25H23N2+ and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-(4-isocyano-1-methylnaphthalen-2-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium.
| Compound Name | 1-(4-isocyano-1-methylnaphthalen-2-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium |
|---|---|
| PubChem CID | 169300962 |
| Molecular Formula | C25H23N2+ |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 1-(4-isocyano-1-methylnaphthalen-2-yl)-2-methyl-6-propan-2-ylisoquinolin-2-ium |
| SMILES | [C-]#[N+]c1cc(-c2c3ccc(C(C)C)cc3cc[n+]2C)c(C)c2ccccc12 |
| InChI | InChI=1S/C25H23N2/c1-16(2)18-10-11-21-19(14-18)12-13-27(5)25(21)23-15-24(26-4)22-9-7-6-8-20(22)17(23)3/h6-16H,1-3,5H3/q+1 |
| InChIKey | NGOHZTGRIPGPAY-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 8.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|