C37H48N+ — CID 166054842
1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-[2,4,6-tri(propan-2-yl)phenyl]isoquinolin-2-ium (PubChem CID 166054842) has the molecular formula C37H48N+ and a molecular weight of 506.80 g/mol. Its IUPAC name is 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-[2,4,6-tri(propan-2-yl)phenyl]isoquinolin-2-ium.
| Compound Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-[2,4,6-tri(propan-2-yl)phenyl]isoquinolin-2-ium |
|---|---|
| PubChem CID | 166054842 |
| Molecular Formula | C37H48N+ |
| Molecular Weight | 506.80 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | 1-(5-tert-butyl-2,3-dimethylphenyl)-2-methyl-6-[2,4,6-tri(propan-2-yl)phenyl]isoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c3ccc(-c4c(C(C)C)cc(C(C)C)cc4C(C)C)cc3cc[n+]2C)c1C |
| InChI | InChI=1S/C37H48N/c1-22(2)29-19-32(23(3)4)35(33(20-29)24(5)6)28-13-14-31-27(18-28)15-16-38(12)36(31)34-21-30(37(9,10)11)17-25(7)26(34)8/h13-24H,1-12H3/q+1 |
| InChIKey | NWUYJVSWQYIQKT-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.80 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|