C41H49N2+ — CID 166054807
4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(4-propan-2-ylphenyl)quinazolin-3-ium (PubChem CID 166054807) has the molecular formula C41H49N2+ and a molecular weight of 569.86 g/mol. Its IUPAC name is 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(4-propan-2-ylphenyl)quinazolin-3-ium.
| Compound Name | 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(4-propan-2-ylphenyl)quinazolin-3-ium |
|---|---|
| PubChem CID | 166054807 |
| Molecular Formula | C41H49N2+ |
| Molecular Weight | 569.86 g/mol |
| Exact Mass | 569.39 |
| IUPAC Name | 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(4-propan-2-ylphenyl)quinazolin-3-ium |
| SMILES | Cc1cc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc(-c2c3ccc(-c4ccc(C(C)C)cc4)cc3nc[n+]2C)c1C |
| InChI | InChI=1S/C41H49N2/c1-24(2)30-12-14-31(15-13-30)32-16-17-35-39(22-32)42-23-43(11)41(35)38-21-34(18-28(9)29(38)10)40-36(26(5)6)19-33(25(3)4)20-37(40)27(7)8/h12-27H,1-11H3/q+1 |
| InChIKey | HQZAECMBJNUXEP-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.86 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|