C36H47N2+ — CID 166054503
4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(2-methylpropyl)quinazolin-3-ium (PubChem CID 166054503) has the molecular formula C36H47N2+ and a molecular weight of 507.79 g/mol. Its IUPAC name is 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(2-methylpropyl)quinazolin-3-ium.
| Compound Name | 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(2-methylpropyl)quinazolin-3-ium |
|---|---|
| PubChem CID | 166054503 |
| Molecular Formula | C36H47N2+ |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | 4-[2,3-dimethyl-5-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-3-methyl-7-(2-methylpropyl)quinazolin-3-ium |
| SMILES | Cc1cc(-c2c(C(C)C)cc(C(C)C)cc2C(C)C)cc(-c2c3ccc(CC(C)C)cc3nc[n+]2C)c1C |
| InChI | InChI=1S/C36H47N2/c1-21(2)14-27-12-13-30-34(16-27)37-20-38(11)36(30)33-19-29(15-25(9)26(33)10)35-31(23(5)6)17-28(22(3)4)18-32(35)24(7)8/h12-13,15-24H,14H2,1-11H3/q+1 |
| InChIKey | DYVGDUALSQWULI-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 16.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|