C27H36N+ — CID 176592435
3-(5-tert-butyl-2,3-dimethylphenyl)-2,4-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium (PubChem CID 176592435) has the molecular formula C27H36N+ and a molecular weight of 374.59 g/mol. Its IUPAC name is 3-(5-tert-butyl-2,3-dimethylphenyl)-2,4-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium.
| Compound Name | 3-(5-tert-butyl-2,3-dimethylphenyl)-2,4-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium |
|---|---|
| PubChem CID | 176592435 |
| Molecular Formula | C27H36N+ |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | 3-(5-tert-butyl-2,3-dimethylphenyl)-2,4-dimethyl-6-(2-methylpropyl)isoquinolin-2-ium |
| SMILES | Cc1cc(C(C)(C)C)cc(-c2c(C)c3cc(CC(C)C)ccc3c[n+]2C)c1C |
| InChI | InChI=1S/C27H36N/c1-17(2)12-21-10-11-22-16-28(9)26(20(5)24(22)14-21)25-15-23(27(6,7)8)13-18(3)19(25)4/h10-11,13-17H,12H2,1-9H3/q+1 |
| InChIKey | NXMXLROECSIWDG-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|