C29H26NO+ — CID 166053996
3,24-dimethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.05,14.08,13.021,25]pentacosa-1(24),2,4,6,8(13),9,11,14,17,19,21(25),22-dodecaene (PubChem CID 166053996) has the molecular formula C29H26NO+ and a molecular weight of 404.53 g/mol. Its IUPAC name is 3,24-dimethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.05,14.08,13.021,25]pentacosa-1(24),2,4,6,8(13),9,11,14,17,19,21(25),22-dodecaene.
| Compound Name | 3,24-dimethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.05,14.08,13.021,25]pentacosa-1(24),2,4,6,8(13),9,11,14,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 166053996 |
| Molecular Formula | C29H26NO+ |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3,24-dimethyl-10-(2-methylpropyl)-16-oxa-3-azoniahexacyclo[15.7.1.02,15.05,14.08,13.021,25]pentacosa-1(24),2,4,6,8(13),9,11,14,17,19,21(25),22-dodecaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c2c(ccc4cc(CC(C)C)ccc42)c[n+]1C)O3 |
| InChI | InChI=1S/C29H26NO/c1-17(2)14-19-9-13-23-21(15-19)11-12-22-16-30(4)28-25-18(3)8-10-20-6-5-7-24(27(20)25)31-29(28)26(22)23/h5-13,15-17H,14H2,1-4H3/q+1 |
| InChIKey | WASCAVHRSAXFJN-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|