C21H22NO+ — CID 166054205
6-tert-butyl-3,16-dimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166054205) has the molecular formula C21H22NO+ and a molecular weight of 304.41 g/mol. Its IUPAC name is 6-tert-butyl-3,16-dimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 6-tert-butyl-3,16-dimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166054205 |
| Molecular Formula | C21H22NO+ |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-tert-butyl-3,16-dimethyl-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c(C(C)(C)C)cc[n+]1C)O3 |
| InChI | InChI=1S/C21H22NO/c1-13-9-10-14-7-6-8-16-18(14)17(13)19-20(23-16)15(21(2,3)4)11-12-22(19)5/h6-12H,1-5H3/q+1 |
| InChIKey | CALYETCRFRLLGY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|