C24H24NO2+ — CID 166053815
7-(2,2-dimethylpropyl)-3,19-dimethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaene (PubChem CID 166053815) has the molecular formula C24H24NO2+ and a molecular weight of 358.46 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-3,19-dimethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaene.
| Compound Name | 7-(2,2-dimethylpropyl)-3,19-dimethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166053815 |
| Molecular Formula | C24H24NO2+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-3,19-dimethyl-6,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.05,9.016,20]icosa-1(19),2,4,7,9,12,14,16(20),17-nonaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c2cc(CC(C)(C)C)oc2c[n+]1C)O3 |
| InChI | InChI=1S/C24H24NO2/c1-14-9-10-15-7-6-8-18-21(15)20(14)22-23(27-18)17-11-16(12-24(2,3)4)26-19(17)13-25(22)5/h6-11,13H,12H2,1-5H3/q+1 |
| InChIKey | CTXGJFGYLVNTQW-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|