C30H28NO+ — CID 166054023
14-(2,2-dimethylpropyl)-3,24-dimethyl-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(24),2,4(13),5,7,9,11,14,17,19,21(25),22-dodecaene (PubChem CID 166054023) has the molecular formula C30H28NO+ and a molecular weight of 418.56 g/mol. Its IUPAC name is 14-(2,2-dimethylpropyl)-3,24-dimethyl-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(24),2,4(13),5,7,9,11,14,17,19,21(25),22-dodecaene.
| Compound Name | 14-(2,2-dimethylpropyl)-3,24-dimethyl-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(24),2,4(13),5,7,9,11,14,17,19,21(25),22-dodecaene |
|---|---|
| PubChem CID | 166054023 |
| Molecular Formula | C30H28NO+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 14-(2,2-dimethylpropyl)-3,24-dimethyl-16-oxa-3-azoniahexacyclo[15.7.1.02,15.04,13.07,12.021,25]pentacosa-1(24),2,4(13),5,7,9,11,14,17,19,21(25),22-dodecaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c(CC(C)(C)C)c2c4ccccc4ccc2[n+]1C)O3 |
| InChI | InChI=1S/C30H28NO/c1-18-13-14-20-10-8-12-24-26(20)25(18)28-29(32-24)22(17-30(2,3)4)27-21-11-7-6-9-19(21)15-16-23(27)31(28)5/h6-16H,17H2,1-5H3/q+1 |
| InChIKey | LRJWDCITTXEYRI-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|