C19H13FNO2+ — CID 166053733
9-fluoro-3,19-dimethyl-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene (PubChem CID 166053733) has the molecular formula C19H13FNO2+ and a molecular weight of 306.32 g/mol. Its IUPAC name is 9-fluoro-3,19-dimethyl-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene.
| Compound Name | 9-fluoro-3,19-dimethyl-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
|---|---|
| PubChem CID | 166053733 |
| Molecular Formula | C19H13FNO2+ |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 9-fluoro-3,19-dimethyl-7,11-dioxa-3-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2,4(8),5,9,12,14,16(20),17-nonaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c(F)c2occc2[n+]1C)O3 |
| InChI | InChI=1S/C19H13FNO2/c1-10-6-7-11-4-3-5-13-15(11)14(10)17-19(23-13)16(20)18-12(21(17)2)8-9-22-18/h3-9H,1-2H3/q+1 |
| InChIKey | UJYHTSKULRFJGM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|