C20H14FN2O+ — CID 166053652
7-fluoro-3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene (PubChem CID 166053652) has the molecular formula C20H14FN2O+ and a molecular weight of 317.34 g/mol. Its IUPAC name is 7-fluoro-3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene.
| Compound Name | 7-fluoro-3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053652 |
| Molecular Formula | C20H14FN2O+ |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 7-fluoro-3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene |
| SMILES | Cc1ccc2cccc3c2c1-c1c(nc2cc(F)ccc2[n+]1C)O3 |
| InChI | InChI=1S/C20H14FN2O/c1-11-6-7-12-4-3-5-16-18(12)17(11)19-20(24-16)22-14-10-13(21)8-9-15(14)23(19)2/h3-10H,1-2H3/q+1 |
| InChIKey | GBJHCFGJJCILCA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|