C28H25N2OSi+ — CID 166053769
(3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaen-7-yl)-dimethyl-phenylsilane (PubChem CID 166053769) has the molecular formula C28H25N2OSi+ and a molecular weight of 433.61 g/mol. Its IUPAC name is (3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaen-7-yl)-dimethyl-phenylsilane.
| Compound Name | (3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaen-7-yl)-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 166053769 |
| Molecular Formula | C28H25N2OSi+ |
| Molecular Weight | 433.61 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (3,20-dimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaen-7-yl)-dimethyl-phenylsilane |
| SMILES | Cc1ccc2cccc3c2c1-c1c(nc2cc([Si](C)(C)c4ccccc4)ccc2[n+]1C)O3 |
| InChI | InChI=1S/C28H25N2OSi/c1-18-13-14-19-9-8-12-24-26(19)25(18)27-28(31-24)29-22-17-21(15-16-23(22)30(27)2)32(3,4)20-10-6-5-7-11-20/h5-17H,1-4H3/q+1 |
| InChIKey | GAEDPNOFRZNJIS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|