C22H16N3O+ — CID 166054163
3,19,20-trimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene-7-carbonitrile (PubChem CID 166054163) has the molecular formula C22H16N3O+ and a molecular weight of 338.39 g/mol. Its IUPAC name is 3,19,20-trimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene-7-carbonitrile.
| Compound Name | 3,19,20-trimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene-7-carbonitrile |
|---|---|
| PubChem CID | 166054163 |
| Molecular Formula | C22H16N3O+ |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 3,19,20-trimethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene-7-carbonitrile |
| SMILES | Cc1cc2cccc3c2c(c1C)-c1c(nc2cc(C#N)ccc2[n+]1C)O3 |
| InChI | InChI=1S/C22H16N3O/c1-12-9-15-5-4-6-18-20(15)19(13(12)2)21-22(26-18)24-16-10-14(11-23)7-8-17(16)25(21)3/h4-10H,1-3H3/q+1 |
| InChIKey | VTNBTSGZVJZJDB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 49.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|