C27H29N2O+ — CID 166053304
7-(2,2-dimethylpropyl)-3,15,19,20-tetramethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene (PubChem CID 166053304) has the molecular formula C27H29N2O+ and a molecular weight of 397.54 g/mol. Its IUPAC name is 7-(2,2-dimethylpropyl)-3,15,19,20-tetramethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene.
| Compound Name | 7-(2,2-dimethylpropyl)-3,15,19,20-tetramethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053304 |
| Molecular Formula | C27H29N2O+ |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 7-(2,2-dimethylpropyl)-3,15,19,20-tetramethyl-12-oxa-10-aza-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4(9),5,7,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2c3c(c(C)c(C)cc3c1)-c1c(nc3cc(CC(C)(C)C)ccc3[n+]1C)O2 |
| InChI | InChI=1S/C27H29N2O/c1-15-10-19-12-16(2)17(3)23-24(19)22(11-15)30-26-25(23)29(7)21-9-8-18(13-20(21)28-26)14-27(4,5)6/h8-13H,14H2,1-7H3/q+1 |
| InChIKey | GILICRSLOVFMPW-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|