C38H45N4O+ — CID 166053639
8-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-15-(2,2-dimethylpropyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053639) has the molecular formula C38H45N4O+ and a molecular weight of 573.81 g/mol. Its IUPAC name is 8-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-15-(2,2-dimethylpropyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 8-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-15-(2,2-dimethylpropyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053639 |
| Molecular Formula | C38H45N4O+ |
| Molecular Weight | 573.81 g/mol |
| Exact Mass | 573.36 |
| IUPAC Name | 8-(4,6-ditert-butyl-1,3,5-triazin-2-yl)-15-(2,2-dimethylpropyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | Cc1cc2cc(CC(C)(C)C)cc3c2c(c1C)-c1c(cc2c(-c4nc(C(C)(C)C)nc(C(C)(C)C)n4)cccc2[n+]1C)O3 |
| InChI | InChI=1S/C38H45N4O/c1-21-16-24-17-23(20-36(3,4)5)18-28-31(24)30(22(21)2)32-29(43-28)19-26-25(14-13-15-27(26)42(32)12)33-39-34(37(6,7)8)41-35(40-33)38(9,10)11/h13-19H,20H2,1-12H3/q+1 |
| InChIKey | NBVFWLQYUHHRAQ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 51.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.81 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|