C29H29N2O+ — CID 166053359
15-(2,2-dimethylpropyl)-8-(isocyanomethyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene (PubChem CID 166053359) has the molecular formula C29H29N2O+ and a molecular weight of 421.56 g/mol. Its IUPAC name is 15-(2,2-dimethylpropyl)-8-(isocyanomethyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene.
| Compound Name | 15-(2,2-dimethylpropyl)-8-(isocyanomethyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
|---|---|
| PubChem CID | 166053359 |
| Molecular Formula | C29H29N2O+ |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 15-(2,2-dimethylpropyl)-8-(isocyanomethyl)-3,19,20-trimethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaene |
| SMILES | [C-]#[N+]Cc1cccc2c1cc1c([n+]2C)-c2c(C)c(C)cc3cc(CC(C)(C)C)cc(c23)O1 |
| InChI | InChI=1S/C29H29N2O/c1-17-11-21-12-19(15-29(3,4)5)13-24-27(21)26(18(17)2)28-25(32-24)14-22-20(16-30-6)9-8-10-23(22)31(28)7/h8-14H,15-16H2,1-5,7H3/q+1 |
| InChIKey | WDSVYLXDVAYUFL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 17.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|