C23H21N2O+ — CID 166053366
N,N,3,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-10-amine (PubChem CID 166053366) has the molecular formula C23H21N2O+ and a molecular weight of 341.43 g/mol. Its IUPAC name is N,N,3,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-10-amine.
| Compound Name | N,N,3,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-10-amine |
|---|---|
| PubChem CID | 166053366 |
| Molecular Formula | C23H21N2O+ |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | N,N,3,20-tetramethyl-12-oxa-3-azoniapentacyclo[11.7.1.02,11.04,9.017,21]henicosa-1(20),2,4,6,8,10,13,15,17(21),18-decaen-10-amine |
| SMILES | Cc1ccc2cccc3c2c1-c1c(c(N(C)C)c2ccccc2[n+]1C)O3 |
| InChI | InChI=1S/C23H21N2O/c1-14-12-13-15-8-7-11-18-20(15)19(14)22-23(26-18)21(24(2)3)16-9-5-6-10-17(16)25(22)4/h5-13H,1-4H3/q+1 |
| InChIKey | UEINOQABGUKAKI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|