C24H22N3O+ — CID 166053149
3,16-dimethyl-6-(2,4,6-trimethylpyrimidin-5-yl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene (PubChem CID 166053149) has the molecular formula C24H22N3O+ and a molecular weight of 368.46 g/mol. Its IUPAC name is 3,16-dimethyl-6-(2,4,6-trimethylpyrimidin-5-yl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene.
| Compound Name | 3,16-dimethyl-6-(2,4,6-trimethylpyrimidin-5-yl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
|---|---|
| PubChem CID | 166053149 |
| Molecular Formula | C24H22N3O+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3,16-dimethyl-6-(2,4,6-trimethylpyrimidin-5-yl)-8-oxa-3-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17),14-octaene |
| SMILES | Cc1nc(C)c(-c2cc[n+](C)c3c2Oc2cccc4ccc(C)c-3c24)c(C)n1 |
| InChI | InChI=1S/C24H22N3O/c1-13-9-10-17-7-6-8-19-22(17)20(13)23-24(28-19)18(11-12-27(23)5)21-14(2)25-16(4)26-15(21)3/h6-12H,1-5H3/q+1 |
| InChIKey | MDGNBNJAOGUPEC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|